| Name | CYCLOHEXANE-1,1-DICARBOXYLIC ACID |
| Synonyms | 1,1-Cyclohexanedicarboxylic acid CYCLOHEXANE-1,1-DICARBOXYLIC ACID Cyclohexane-1,1-dicarboxylic acid Thieno[2,3-c]pyridine-3-carboxylicacid,2-amino-4,5,6,7-tetrahydro-10-(phenylmethyl)-,ethylester |
| CAS | 1127-08-8 |
| InChI | InChI=1/C8H12O4/c9-6(10)8(7(11)12)4-2-1-3-5-8/h1-5H2,(H,9,10)(H,11,12) |
| Molecular Formula | C8H12O4 |
| Molar Mass | 172.18 |
| Density | 1.330±0.06 g/cm3(Predicted) |
| Melting Point | 175.5-176.5°C |
| Boling Point | 375.4±25.0 °C(Predicted) |
| Flash Point | 195°C |
| Vapor Presure | 1.13E-06mmHg at 25°C |
| pKa | 4.61±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.527 |
| MDL | MFCD00094668 |
| Risk Codes | R25 - Toxic if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37 - Wear suitable protective clothing and gloves. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |